C18H23F3O — CID 154531292
2-methyl-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 154531292) has the molecular formula C18H23F3O and a molecular weight of 312.38 g/mol. Its IUPAC name is 2-methyl-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-methyl-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 154531292 |
| Molecular Formula | C18H23F3O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-methyl-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CC1CCC2CC(c3ccc(OC(F)(F)F)cc3)CCC2C1 |
| InChI | InChI=1S/C18H23F3O/c1-12-2-3-16-11-15(5-4-14(16)10-12)13-6-8-17(9-7-13)22-18(19,20)21/h6-9,12,14-16H,2-5,10-11H2,1H3 |
| InChIKey | RJWKFMRVGCCSRM-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |