C24H25F5 — CID 22385102
2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 22385102) has the molecular formula C24H25F5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 22385102 |
| Molecular Formula | C24H25F5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CC1CCC2CC(c3ccc(-c4cc(F)c(C(F)(F)F)c(F)c4)cc3)CCC2C1 |
| InChI | InChI=1S/C24H25F5/c1-14-2-3-19-11-18(9-8-17(19)10-14)15-4-6-16(7-5-15)20-12-21(25)23(22(26)13-20)24(27,28)29/h4-7,12-14,17-19H,2-3,8-11H2,1H3 |
| InChIKey | DBLKEUGNYQXXTJ-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |