C24H26F4O — CID 20809401
(2R,4aR,8aR)-2-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809401) has the molecular formula C24H26F4O and a molecular weight of 406.46 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809401 |
| Molecular Formula | C24H26F4O |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (2R,4aR,8aR)-2-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CC1CC[C@@H]2C[C@H](c3ccc(-c4ccc(OC(F)(F)F)c(F)c4)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C24H26F4O/c1-15-2-3-20-13-19(9-8-18(20)12-15)16-4-6-17(7-5-16)21-10-11-23(22(25)14-21)29-24(26,27)28/h4-7,10-11,14-15,18-20H,2-3,8-9,12-13H2,1H3/t15?,18-,19-,20-/m1/s1 |
| InChIKey | PFEDQWJYAMAJTH-NKSDPYKRSA-N |
| XLogP | 7.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |