C20H23FO — CID 144809449
2-fluoro-1-methoxy-4-[4-(4-methylcyclohexyl)phenyl]benzene (PubChem CID 144809449) has the molecular formula C20H23FO and a molecular weight of 298.40 g/mol. Its IUPAC name is 2-fluoro-1-methoxy-4-[4-(4-methylcyclohexyl)phenyl]benzene.
| Compound Name | 2-fluoro-1-methoxy-4-[4-(4-methylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 144809449 |
| Molecular Formula | C20H23FO |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-fluoro-1-methoxy-4-[4-(4-methylcyclohexyl)phenyl]benzene |
| SMILES | COc1ccc(-c2ccc(C3CCC(C)CC3)cc2)cc1F |
| InChI | InChI=1S/C20H23FO/c1-14-3-5-15(6-4-14)16-7-9-17(10-8-16)18-11-12-20(22-2)19(21)13-18/h7-15H,3-6H2,1-2H3 |
| InChIKey | NUJZJYKEXPJGDS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |