C23H29FO — CID 144809398
2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]-1-(2-methylpropoxy)benzene (PubChem CID 144809398) has the molecular formula C23H29FO and a molecular weight of 340.48 g/mol. Its IUPAC name is 2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]-1-(2-methylpropoxy)benzene.
| Compound Name | 2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]-1-(2-methylpropoxy)benzene |
|---|---|
| PubChem CID | 144809398 |
| Molecular Formula | C23H29FO |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]-1-(2-methylpropoxy)benzene |
| SMILES | CC(C)COc1ccc(-c2ccc(C3CCC(C)CC3)cc2)cc1F |
| InChI | InChI=1S/C23H29FO/c1-16(2)15-25-23-13-12-21(14-22(23)24)20-10-8-19(9-11-20)18-6-4-17(3)5-7-18/h8-14,16-18H,4-7,15H2,1-3H3 |
| InChIKey | MLQYPOAPOAUPHY-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |