C21H29F5O — CID 157103030
2-fluoro-1-(fluoromethoxy)-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene;fluoroform (PubChem CID 157103030) has the molecular formula C21H29F5O and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-fluoro-1-(fluoromethoxy)-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene;fluoroform.
| Compound Name | 2-fluoro-1-(fluoromethoxy)-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene;fluoroform |
|---|---|
| PubChem CID | 157103030 |
| Molecular Formula | C21H29F5O |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 2-fluoro-1-(fluoromethoxy)-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene;fluoroform |
| SMILES | CC1CCC(C2CCC(c3ccc(OCF)c(F)c3)CC2)CC1.FC(F)F |
| InChI | InChI=1S/C20H28F2O.CHF3/c1-14-2-4-15(5-3-14)16-6-8-17(9-7-16)18-10-11-20(23-13-21)19(22)12-18;2-1(3)4/h10-12,14-17H,2-9,13H2,1H3;1H |
| InChIKey | AFZFEELDNQAYBG-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |