C24H31F7O — CID 22080061
2-fluoro-1-(1,1,2,2,3,3-hexafluoropropoxy)-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene (PubChem CID 22080061) has the molecular formula C24H31F7O and a molecular weight of 468.50 g/mol. Its IUPAC name is 2-fluoro-1-(1,1,2,2,3,3-hexafluoropropoxy)-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 2-fluoro-1-(1,1,2,2,3,3-hexafluoropropoxy)-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 22080061 |
| Molecular Formula | C24H31F7O |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 2-fluoro-1-(1,1,2,2,3,3-hexafluoropropoxy)-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
| SMILES | CCCC1CCC(C2CCC(c3ccc(OC(F)(F)C(F)(F)C(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H31F7O/c1-2-3-15-4-6-16(7-5-15)17-8-10-18(11-9-17)19-12-13-21(20(25)14-19)32-24(30,31)23(28,29)22(26)27/h12-18,22H,2-11H2,1H3 |
| InChIKey | WNDMGSAQGGDUGC-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|