C16H22F2O — CID 70841823
2-fluoro-1-(fluoromethoxy)-4-(4-propylcyclohexyl)benzene (PubChem CID 70841823) has the molecular formula C16H22F2O and a molecular weight of 268.35 g/mol. Its IUPAC name is 2-fluoro-1-(fluoromethoxy)-4-(4-propylcyclohexyl)benzene.
| Compound Name | 2-fluoro-1-(fluoromethoxy)-4-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 70841823 |
| Molecular Formula | C16H22F2O |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-fluoro-1-(fluoromethoxy)-4-(4-propylcyclohexyl)benzene |
| SMILES | CCCC1CCC(c2ccc(OCF)c(F)c2)CC1 |
| InChI | InChI=1S/C16H22F2O/c1-2-3-12-4-6-13(7-5-12)14-8-9-16(19-11-17)15(18)10-14/h8-10,12-13H,2-7,11H2,1H3 |
| InChIKey | FXNITINITQGYSW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |