C27H30F6O3 — CID 20656717
2-[4-[3-fluoro-4-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]cyclohexyl]-5-propyl-1,3-dioxane (PubChem CID 20656717) has the molecular formula C27H30F6O3 and a molecular weight of 516.52 g/mol. Its IUPAC name is 2-[4-[3-fluoro-4-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]cyclohexyl]-5-propyl-1,3-dioxane.
| Compound Name | 2-[4-[3-fluoro-4-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]cyclohexyl]-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 20656717 |
| Molecular Formula | C27H30F6O3 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 2-[4-[3-fluoro-4-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]cyclohexyl]-5-propyl-1,3-dioxane |
| SMILES | CCCC1COC(C2CCC(c3ccc(-c4ccc(OC(F)(F)C(F)F)c(F)c4)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C27H30F6O3/c1-2-3-16-14-34-25(35-15-16)18-6-4-17(5-7-18)19-8-10-21(22(28)12-19)20-9-11-24(23(29)13-20)36-27(32,33)26(30)31/h8-13,16-18,25-26H,2-7,14-15H2,1H3 |
| InChIKey | OWPNSDSOHODTMI-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|