C20H29FO2 — CID 20656727
2-[4-(3-fluoro-4-methylphenyl)cyclohexyl]-5-propyl-1,3-dioxane (PubChem CID 20656727) has the molecular formula C20H29FO2 and a molecular weight of 320.45 g/mol. Its IUPAC name is 2-[4-(3-fluoro-4-methylphenyl)cyclohexyl]-5-propyl-1,3-dioxane.
| Compound Name | 2-[4-(3-fluoro-4-methylphenyl)cyclohexyl]-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 20656727 |
| Molecular Formula | C20H29FO2 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 2-[4-(3-fluoro-4-methylphenyl)cyclohexyl]-5-propyl-1,3-dioxane |
| SMILES | CCCC1COC(C2CCC(c3ccc(C)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C20H29FO2/c1-3-4-15-12-22-20(23-13-15)17-9-7-16(8-10-17)18-6-5-14(2)19(21)11-18/h5-6,11,15-17,20H,3-4,7-10,12-13H2,1-2H3 |
| InChIKey | QKVKNZFRFYAXDF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |