C25H37F3O2 — CID 150918398
5-nonyl-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]-1,3-dioxane (PubChem CID 150918398) has the molecular formula C25H37F3O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 5-nonyl-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]-1,3-dioxane.
| Compound Name | 5-nonyl-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 150918398 |
| Molecular Formula | C25H37F3O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 5-nonyl-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]-1,3-dioxane |
| SMILES | CCCCCCCCCC1COC(C2CCC(c3cc(F)c(F)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C25H37F3O2/c1-2-3-4-5-6-7-8-9-18-16-29-25(30-17-18)20-12-10-19(11-13-20)21-14-22(26)24(28)23(27)15-21/h14-15,18-20,25H,2-13,16-17H2,1H3 |
| InChIKey | LDMMRYQRCKGXEZ-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|