C30H43ClF6O2 — CID 158294877
2-[chloro(difluoro)methyl]-1,3-difluoro-5-(4-fluorocyclohexyl)benzene;2-[4-(2-fluoroethyl)cyclohexyl]-5-pentyl-1,3-dioxane (PubChem CID 158294877) has the molecular formula C30H43ClF6O2 and a molecular weight of 585.11 g/mol. Its IUPAC name is 2-[chloro(difluoro)methyl]-1,3-difluoro-5-(4-fluorocyclohexyl)benzene;2-[4-(2-fluoroethyl)cyclohexyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[chloro(difluoro)methyl]-1,3-difluoro-5-(4-fluorocyclohexyl)benzene;2-[4-(2-fluoroethyl)cyclohexyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 158294877 |
| Molecular Formula | C30H43ClF6O2 |
| Molecular Weight | 585.11 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | 2-[chloro(difluoro)methyl]-1,3-difluoro-5-(4-fluorocyclohexyl)benzene;2-[4-(2-fluoroethyl)cyclohexyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(C2CCC(CCF)CC2)OC1.Fc1cc(C2CCC(F)CC2)cc(F)c1C(F)(F)Cl |
| InChI | InChI=1S/C17H31FO2.C13H12ClF5/c1-2-3-4-5-15-12-19-17(20-13-15)16-8-6-14(7-9-16)10-11-18;14-13(18,19)12-10(16)5-8(6-11(12)17)7-1-3-9(15)4-2-7/h14-17H,2-13H2,1H3;5-7,9H,1-4H2 |
| InChIKey | GLUDNKPIZKHPGQ-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.11 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|