C28H39ClF4 — CID 20654099
2-[chloro(difluoro)methyl]-1,3-difluoro-5-[4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexyl]benzene (PubChem CID 20654099) has the molecular formula C28H39ClF4 and a molecular weight of 487.07 g/mol. Its IUPAC name is 2-[chloro(difluoro)methyl]-1,3-difluoro-5-[4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexyl]benzene.
| Compound Name | 2-[chloro(difluoro)methyl]-1,3-difluoro-5-[4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 20654099 |
| Molecular Formula | C28H39ClF4 |
| Molecular Weight | 487.07 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 2-[chloro(difluoro)methyl]-1,3-difluoro-5-[4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexyl]benzene |
| SMILES | CCCC1CCC(C2CCC(C3CCC(c4cc(F)c(C(F)(F)Cl)c(F)c4)CC3)CC2)CC1 |
| InChI | InChI=1S/C28H39ClF4/c1-2-3-18-4-6-19(7-5-18)20-8-10-21(11-9-20)22-12-14-23(15-13-22)24-16-25(30)27(26(31)17-24)28(29,32)33/h16-23H,2-15H2,1H3 |
| InChIKey | KTGOWFNPOIPMNA-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.07 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|