C15H17ClF4O — CID 20654136
2-[chloro(difluoro)methyl]-5-(4-ethoxycyclohexyl)-1,3-difluorobenzene (PubChem CID 20654136) has the molecular formula C15H17ClF4O and a molecular weight of 324.75 g/mol. Its IUPAC name is 2-[chloro(difluoro)methyl]-5-(4-ethoxycyclohexyl)-1,3-difluorobenzene.
| Compound Name | 2-[chloro(difluoro)methyl]-5-(4-ethoxycyclohexyl)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 20654136 |
| Molecular Formula | C15H17ClF4O |
| Molecular Weight | 324.75 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-[chloro(difluoro)methyl]-5-(4-ethoxycyclohexyl)-1,3-difluorobenzene |
| SMILES | CCOC1CCC(c2cc(F)c(C(F)(F)Cl)c(F)c2)CC1 |
| InChI | InChI=1S/C15H17ClF4O/c1-2-21-11-5-3-9(4-6-11)10-7-12(17)14(13(18)8-10)15(16,19)20/h7-9,11H,2-6H2,1H3 |
| InChIKey | IBOUYJDOUFUMOD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.75 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|