C30H41ClF4 — CID 20654096
2-[chloro(difluoro)methyl]-1,3-difluoro-5-[4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]cyclohexyl]benzene (PubChem CID 20654096) has the molecular formula C30H41ClF4 and a molecular weight of 513.10 g/mol. Its IUPAC name is 2-[chloro(difluoro)methyl]-1,3-difluoro-5-[4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]cyclohexyl]benzene.
| Compound Name | 2-[chloro(difluoro)methyl]-1,3-difluoro-5-[4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 20654096 |
| Molecular Formula | C30H41ClF4 |
| Molecular Weight | 513.10 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 2-[chloro(difluoro)methyl]-1,3-difluoro-5-[4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]cyclohexyl]benzene |
| SMILES | C/C=C/CCC1CCC(C2CCC(C3CCC(c4cc(F)c(C(F)(F)Cl)c(F)c4)CC3)CC2)CC1 |
| InChI | InChI=1S/C30H41ClF4/c1-2-3-4-5-20-6-8-21(9-7-20)22-10-12-23(13-11-22)24-14-16-25(17-15-24)26-18-27(32)29(28(33)19-26)30(31,34)35/h2-3,18-25H,4-17H2,1H3/b3-2+ |
| InChIKey | KXTGVWAMKUMDSN-NSCUHMNNSA-N |
| XLogP | 10.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.10 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|