C26H40 — CID 54434851
1,2,3-trimethyl-5-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]benzene (PubChem CID 54434851) has the molecular formula C26H40 and a molecular weight of 352.61 g/mol. Its IUPAC name is 1,2,3-trimethyl-5-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]benzene.
| Compound Name | 1,2,3-trimethyl-5-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 54434851 |
| Molecular Formula | C26H40 |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | 1,2,3-trimethyl-5-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]benzene |
| SMILES | C/C=C/CCC1CCC(C2CCC(c3cc(C)c(C)c(C)c3)CC2)CC1 |
| InChI | InChI=1S/C26H40/c1-5-6-7-8-22-9-11-23(12-10-22)24-13-15-25(16-14-24)26-17-19(2)21(4)20(3)18-26/h5-6,17-18,22-25H,7-16H2,1-4H3/b6-5+ |
| InChIKey | WJZZYYZIHUYCRX-AATRIKPKSA-N |
| XLogP | 8.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|