C25H36I2 — CID 160521373
5-[4-(4-buta-2,3-dienylcyclohexyl)cyclohexyl]-1,2,3-trimethylbenzene;molecular iodine (PubChem CID 160521373) has the molecular formula C25H36I2 and a molecular weight of 590.37 g/mol. Its IUPAC name is 5-[4-(4-buta-2,3-dienylcyclohexyl)cyclohexyl]-1,2,3-trimethylbenzene;molecular iodine.
| Compound Name | 5-[4-(4-buta-2,3-dienylcyclohexyl)cyclohexyl]-1,2,3-trimethylbenzene;molecular iodine |
|---|---|
| PubChem CID | 160521373 |
| Molecular Formula | C25H36I2 |
| Molecular Weight | 590.37 g/mol |
| Exact Mass | 590.09 |
| IUPAC Name | 5-[4-(4-buta-2,3-dienylcyclohexyl)cyclohexyl]-1,2,3-trimethylbenzene;molecular iodine |
| SMILES | C=C=CCC1CCC(C2CCC(c3cc(C)c(C)c(C)c3)CC2)CC1.II |
| InChI | InChI=1S/C25H36.I2/c1-5-6-7-21-8-10-22(11-9-21)23-12-14-24(15-13-23)25-16-18(2)20(4)19(3)17-25;1-2/h6,16-17,21-24H,1,7-15H2,2-4H3; |
| InChIKey | QUHUNVFIVYNQIF-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.37 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|