C24H33F3 — CID 67589936
1,2,3-trifluoro-5-[4-[4-[(E)-hex-2-enyl]cyclohexyl]cyclohexyl]benzene (PubChem CID 67589936) has the molecular formula C24H33F3 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[4-[4-[(E)-hex-2-enyl]cyclohexyl]cyclohexyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[4-[4-[(E)-hex-2-enyl]cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 67589936 |
| Molecular Formula | C24H33F3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 1,2,3-trifluoro-5-[4-[4-[(E)-hex-2-enyl]cyclohexyl]cyclohexyl]benzene |
| SMILES | CCC/C=C/CC1CCC(C2CCC(c3cc(F)c(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H33F3/c1-2-3-4-5-6-17-7-9-18(10-8-17)19-11-13-20(14-12-19)21-15-22(25)24(27)23(26)16-21/h4-5,15-20H,2-3,6-14H2,1H3/b5-4+ |
| InChIKey | PGQGQYQMPZLIBC-SNAWJCMRSA-N |
| XLogP | 7.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|