C24H32F4 — CID 19695248
1,2,3-trifluoro-5-[4-[4-[(E)-6-fluorohex-2-enyl]cyclohexyl]cyclohexyl]benzene (PubChem CID 19695248) has the molecular formula C24H32F4 and a molecular weight of 396.51 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[4-[4-[(E)-6-fluorohex-2-enyl]cyclohexyl]cyclohexyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[4-[4-[(E)-6-fluorohex-2-enyl]cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 19695248 |
| Molecular Formula | C24H32F4 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 1,2,3-trifluoro-5-[4-[4-[(E)-6-fluorohex-2-enyl]cyclohexyl]cyclohexyl]benzene |
| SMILES | FCCC/C=C/CC1CCC(C2CCC(c3cc(F)c(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H32F4/c25-14-4-2-1-3-5-17-6-8-18(9-7-17)19-10-12-20(13-11-19)21-15-22(26)24(28)23(27)16-21/h1,3,15-20H,2,4-14H2/b3-1+ |
| InChIKey | KJXGKYRFQMQUQE-HNQUOIGGSA-N |
| XLogP | 7.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|