C25H34F4 — CID 19695249
1,2,3-trifluoro-5-[4-[2-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]ethyl]cyclohexyl]benzene (PubChem CID 19695249) has the molecular formula C25H34F4 and a molecular weight of 410.54 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[4-[2-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]ethyl]cyclohexyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[4-[2-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]ethyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 19695249 |
| Molecular Formula | C25H34F4 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 1,2,3-trifluoro-5-[4-[2-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]ethyl]cyclohexyl]benzene |
| SMILES | FCCC/C=C/C1CCC(CCC2CCC(c3cc(F)c(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H34F4/c26-15-3-1-2-4-18-5-7-19(8-6-18)9-10-20-11-13-21(14-12-20)22-16-23(27)25(29)24(28)17-22/h2,4,16-21H,1,3,5-15H2/b4-2+ |
| InChIKey | NBWPHAGLUJUDLR-DUXPYHPUSA-N |
| XLogP | 8.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|