C25H33F5 — CID 139629305
5-[4-[(E)-4-(4-ethylcyclohexyl)but-3-enyl]cyclohexyl]-1,3-difluoro-2-(trifluoromethyl)benzene (PubChem CID 139629305) has the molecular formula C25H33F5 and a molecular weight of 428.53 g/mol. Its IUPAC name is 5-[4-[(E)-4-(4-ethylcyclohexyl)but-3-enyl]cyclohexyl]-1,3-difluoro-2-(trifluoromethyl)benzene.
| Compound Name | 5-[4-[(E)-4-(4-ethylcyclohexyl)but-3-enyl]cyclohexyl]-1,3-difluoro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 139629305 |
| Molecular Formula | C25H33F5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 5-[4-[(E)-4-(4-ethylcyclohexyl)but-3-enyl]cyclohexyl]-1,3-difluoro-2-(trifluoromethyl)benzene |
| SMILES | CCC1CCC(/C=C/CCC2CCC(c3cc(F)c(C(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H33F5/c1-2-17-7-9-18(10-8-17)5-3-4-6-19-11-13-20(14-12-19)21-15-22(26)24(23(27)16-21)25(28,29)30/h3,5,15-20H,2,4,6-14H2,1H3/b5-3+ |
| InChIKey | FZSHREVGQGKAQR-HWKANZROSA-N |
| XLogP | 8.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|