C27H38F4 — CID 139629362
4-[4-[(E)-4-(4-butylcyclohexyl)but-3-enyl]cyclohexyl]-2-fluoro-1-(trifluoromethyl)benzene (PubChem CID 139629362) has the molecular formula C27H38F4 and a molecular weight of 438.59 g/mol. Its IUPAC name is 4-[4-[(E)-4-(4-butylcyclohexyl)but-3-enyl]cyclohexyl]-2-fluoro-1-(trifluoromethyl)benzene.
| Compound Name | 4-[4-[(E)-4-(4-butylcyclohexyl)but-3-enyl]cyclohexyl]-2-fluoro-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 139629362 |
| Molecular Formula | C27H38F4 |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 4-[4-[(E)-4-(4-butylcyclohexyl)but-3-enyl]cyclohexyl]-2-fluoro-1-(trifluoromethyl)benzene |
| SMILES | CCCCC1CCC(/C=C/CCC2CCC(c3ccc(C(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C27H38F4/c1-2-3-6-20-9-11-21(12-10-20)7-4-5-8-22-13-15-23(16-14-22)24-17-18-25(26(28)19-24)27(29,30)31/h4,7,17-23H,2-3,5-6,8-16H2,1H3/b7-4+ |
| InChIKey | MIRYATRREZXYCE-QPJJXVBHSA-N |
| XLogP | 9.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|