C17H18F6 — CID 54065273
4-[4-(4,4-difluorobut-1-enyl)cyclohexyl]-2-fluoro-1-(trifluoromethyl)benzene (PubChem CID 54065273) has the molecular formula C17H18F6 and a molecular weight of 336.32 g/mol. Its IUPAC name is 4-[4-(4,4-difluorobut-1-enyl)cyclohexyl]-2-fluoro-1-(trifluoromethyl)benzene.
| Compound Name | 4-[4-(4,4-difluorobut-1-enyl)cyclohexyl]-2-fluoro-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 54065273 |
| Molecular Formula | C17H18F6 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-[4-(4,4-difluorobut-1-enyl)cyclohexyl]-2-fluoro-1-(trifluoromethyl)benzene |
| SMILES | Fc1cc(C2CCC(C=CCC(F)F)CC2)ccc1C(F)(F)F |
| InChI | InChI=1S/C17H18F6/c18-15-10-13(8-9-14(15)17(21,22)23)12-6-4-11(5-7-12)2-1-3-16(19)20/h1-2,8-12,16H,3-7H2 |
| InChIKey | MCMKXVZJOZJIIB-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|