C17H19F2N — CID 18179288
4-[4-[(E)-4,4-difluorobut-1-enyl]cyclohexyl]benzonitrile (PubChem CID 18179288) has the molecular formula C17H19F2N and a molecular weight of 275.34 g/mol. Its IUPAC name is 4-[4-[(E)-4,4-difluorobut-1-enyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[(E)-4,4-difluorobut-1-enyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 18179288 |
| Molecular Formula | C17H19F2N |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 4-[4-[(E)-4,4-difluorobut-1-enyl]cyclohexyl]benzonitrile |
| SMILES | N#Cc1ccc(C2CCC(/C=C/CC(F)F)CC2)cc1 |
| InChI | InChI=1S/C17H19F2N/c18-17(19)3-1-2-13-4-8-15(9-5-13)16-10-6-14(12-20)7-11-16/h1-2,6-7,10-11,13,15,17H,3-5,8-9H2/b2-1+ |
| InChIKey | SRURVCBRHBWSQF-OWOJBTEDSA-N |
| XLogP | 5.04 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|