C26H30N2 — CID 54122592
4-[4-[2-[4-(4-cyanobuta-1,3-dienyl)cyclohexyl]ethenyl]cyclohexyl]benzonitrile (PubChem CID 54122592) has the molecular formula C26H30N2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 4-[4-[2-[4-(4-cyanobuta-1,3-dienyl)cyclohexyl]ethenyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[2-[4-(4-cyanobuta-1,3-dienyl)cyclohexyl]ethenyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 54122592 |
| Molecular Formula | C26H30N2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 4-[4-[2-[4-(4-cyanobuta-1,3-dienyl)cyclohexyl]ethenyl]cyclohexyl]benzonitrile |
| SMILES | N#CC=CC=CC1CCC(C=CC2CCC(c3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C26H30N2/c27-19-3-1-2-4-21-5-7-22(8-6-21)9-10-23-11-15-25(16-12-23)26-17-13-24(20-28)14-18-26/h1-4,9-10,13-14,17-18,21-23,25H,5-8,11-12,15-16H2 |
| InChIKey | NOUBJUYEOLFEHW-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|