C26H34N2 — CID 54259346
4-[4-[4-[4-(2-cyanoethenyl)cyclohexyl]butyl]cyclohexyl]benzonitrile (PubChem CID 54259346) has the molecular formula C26H34N2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 4-[4-[4-[4-(2-cyanoethenyl)cyclohexyl]butyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[4-[4-(2-cyanoethenyl)cyclohexyl]butyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 54259346 |
| Molecular Formula | C26H34N2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 4-[4-[4-[4-(2-cyanoethenyl)cyclohexyl]butyl]cyclohexyl]benzonitrile |
| SMILES | N#CC=CC1CCC(CCCCC2CCC(c3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C26H34N2/c27-19-3-6-23-9-7-21(8-10-23)4-1-2-5-22-11-15-25(16-12-22)26-17-13-24(20-28)14-18-26/h3,6,13-14,17-18,21-23,25H,1-2,4-5,7-12,15-16H2 |
| InChIKey | RCJHQYJHNAASND-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|