C28H36N2 — CID 54518857
4-[4-[4-[4-(4-cyanobuta-1,3-dienyl)cyclohexyl]cyclohexyl]butyl]benzonitrile (PubChem CID 54518857) has the molecular formula C28H36N2 and a molecular weight of 400.61 g/mol. Its IUPAC name is 4-[4-[4-[4-(4-cyanobuta-1,3-dienyl)cyclohexyl]cyclohexyl]butyl]benzonitrile.
| Compound Name | 4-[4-[4-[4-(4-cyanobuta-1,3-dienyl)cyclohexyl]cyclohexyl]butyl]benzonitrile |
|---|---|
| PubChem CID | 54518857 |
| Molecular Formula | C28H36N2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | 4-[4-[4-[4-(4-cyanobuta-1,3-dienyl)cyclohexyl]cyclohexyl]butyl]benzonitrile |
| SMILES | N#CC=CC=CC1CCC(C2CCC(CCCCc3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C28H36N2/c29-21-5-1-2-6-24-13-17-27(18-14-24)28-19-15-25(16-20-28)8-4-3-7-23-9-11-26(22-30)12-10-23/h1-2,5-6,9-12,24-25,27-28H,3-4,7-8,13-20H2 |
| InChIKey | YOIMWSPDQHFZJI-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|