C19H21F2N — CID 19613546
(2E,4E)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]penta-2,4-dienenitrile (PubChem CID 19613546) has the molecular formula C19H21F2N and a molecular weight of 301.38 g/mol. Its IUPAC name is (2E,4E)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]penta-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 19613546 |
| Molecular Formula | C19H21F2N |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | (2E,4E)-5-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]penta-2,4-dienenitrile |
| SMILES | N#C/C=C/C=C/C1CCC(CCc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H21F2N/c20-18-12-11-17(14-19(18)21)10-9-16-7-5-15(6-8-16)4-2-1-3-13-22/h1-4,11-12,14-16H,5-10H2/b3-1+,4-2+ |
| InChIKey | PFOPVARHARIFOS-ZPUQHVIOSA-N |
| XLogP | 5.34 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|