C19H23F2N — CID 19695389
2-fluoro-4-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]benzonitrile (PubChem CID 19695389) has the molecular formula C19H23F2N and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-fluoro-4-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]benzonitrile.
| Compound Name | 2-fluoro-4-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 19695389 |
| Molecular Formula | C19H23F2N |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-fluoro-4-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]benzonitrile |
| SMILES | N#Cc1ccc(CCC2CCC(/C=C/CCF)CC2)cc1F |
| InChI | InChI=1S/C19H23F2N/c20-12-2-1-3-15-4-6-16(7-5-15)8-9-17-10-11-18(14-22)19(21)13-17/h1,3,10-11,13,15-16H,2,4-9,12H2/b3-1+ |
| InChIKey | NDCLPLWMWZNORX-HNQUOIGGSA-N |
| XLogP | 5.35 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|