C24H32ClF3 — CID 19695462
2-chloro-1,3-difluoro-5-[2-[4-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]cyclohexyl]ethyl]benzene (PubChem CID 19695462) has the molecular formula C24H32ClF3 and a molecular weight of 412.97 g/mol. Its IUPAC name is 2-chloro-1,3-difluoro-5-[2-[4-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]cyclohexyl]ethyl]benzene.
| Compound Name | 2-chloro-1,3-difluoro-5-[2-[4-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]cyclohexyl]ethyl]benzene |
|---|---|
| PubChem CID | 19695462 |
| Molecular Formula | C24H32ClF3 |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 2-chloro-1,3-difluoro-5-[2-[4-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]cyclohexyl]ethyl]benzene |
| SMILES | FCC/C=C/C1CCC(C2CCC(CCc3cc(F)c(Cl)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H32ClF3/c25-24-22(27)15-19(16-23(24)28)5-4-18-8-12-21(13-9-18)20-10-6-17(7-11-20)3-1-2-14-26/h1,3,15-18,20-21H,2,4-14H2/b3-1+ |
| InChIKey | NBMNPGOVKIXRMR-HNQUOIGGSA-N |
| XLogP | 8.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|