C25H27F5 — CID 19695183
2-fluoro-4-[4-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]phenyl]-1-(trifluoromethyl)benzene (PubChem CID 19695183) has the molecular formula C25H27F5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-fluoro-4-[4-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]phenyl]-1-(trifluoromethyl)benzene.
| Compound Name | 2-fluoro-4-[4-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]phenyl]-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 19695183 |
| Molecular Formula | C25H27F5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-fluoro-4-[4-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]phenyl]-1-(trifluoromethyl)benzene |
| SMILES | FCC/C=C/C1CCC(CCc2ccc(-c3ccc(C(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C25H27F5/c26-16-2-1-3-18-4-6-19(7-5-18)8-9-20-10-12-21(13-11-20)22-14-15-23(24(27)17-22)25(28,29)30/h1,3,10-15,17-19H,2,4-9,16H2/b3-1+ |
| InChIKey | HQIKISMHCMCUPY-HNQUOIGGSA-N |
| XLogP | 8.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|