C22H24F4 — CID 20654453
2-fluoro-4-[4-[2-(4-methylcyclohexyl)ethyl]phenyl]-1-(trifluoromethyl)benzene (PubChem CID 20654453) has the molecular formula C22H24F4 and a molecular weight of 364.43 g/mol. Its IUPAC name is 2-fluoro-4-[4-[2-(4-methylcyclohexyl)ethyl]phenyl]-1-(trifluoromethyl)benzene.
| Compound Name | 2-fluoro-4-[4-[2-(4-methylcyclohexyl)ethyl]phenyl]-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 20654453 |
| Molecular Formula | C22H24F4 |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-fluoro-4-[4-[2-(4-methylcyclohexyl)ethyl]phenyl]-1-(trifluoromethyl)benzene |
| SMILES | CC1CCC(CCc2ccc(-c3ccc(C(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C22H24F4/c1-15-2-4-16(5-3-15)6-7-17-8-10-18(11-9-17)19-12-13-20(21(23)14-19)22(24,25)26/h8-16H,2-7H2,1H3 |
| InChIKey | KGBBQWPLKQRAND-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |