C22H25F3 — CID 22886828
1-[2-(4-methylcyclohexyl)ethyl]-4-[4-(trifluoromethyl)phenyl]benzene (PubChem CID 22886828) has the molecular formula C22H25F3 and a molecular weight of 346.44 g/mol. Its IUPAC name is 1-[2-(4-methylcyclohexyl)ethyl]-4-[4-(trifluoromethyl)phenyl]benzene.
| Compound Name | 1-[2-(4-methylcyclohexyl)ethyl]-4-[4-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 22886828 |
| Molecular Formula | C22H25F3 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-[2-(4-methylcyclohexyl)ethyl]-4-[4-(trifluoromethyl)phenyl]benzene |
| SMILES | CC1CCC(CCc2ccc(-c3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H25F3/c1-16-2-4-17(5-3-16)6-7-18-8-10-19(11-9-18)20-12-14-21(15-13-20)22(23,24)25/h8-17H,2-7H2,1H3 |
| InChIKey | OCKYXMMBUGVPFA-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |