C16H23Si — CID 20632303
CID 20632303 (PubChem CID 20632303) has the molecular formula C16H23Si and a molecular weight of 243.45 g/mol.
| Compound Name | CID 20632303 |
|---|---|
| PubChem CID | 20632303 |
| Molecular Formula | C16H23Si |
| Molecular Weight | 243.45 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | — |
| SMILES | CC1CCC(CCc2ccc(C[Si])cc2)CC1 |
| InChI | InChI=1S/C16H23Si/c1-13-2-4-14(5-3-13)6-7-15-8-10-16(12-17)11-9-15/h8-11,13-14H,2-7,12H2,1H3 |
| InChIKey | VRYUFMRTNJTSFS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|