C27H35Y- — CID 59931239
1-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]-4-phenylbenzene;yttrium (PubChem CID 59931239) has the molecular formula C27H35Y- and a molecular weight of 448.48 g/mol. Its IUPAC name is 1-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]-4-phenylbenzene;yttrium.
| Compound Name | 1-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]-4-phenylbenzene;yttrium |
|---|---|
| PubChem CID | 59931239 |
| Molecular Formula | C27H35Y- |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 1-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]-4-phenylbenzene;yttrium |
| SMILES | CC1CCC(C2CCC(CCc3ccc(-c4cc[c-]cc4)cc3)CC2)CC1.[Y] |
| InChI | InChI=1S/C27H35.Y/c1-21-7-15-25(16-8-21)27-19-13-23(14-20-27)10-9-22-11-17-26(18-12-22)24-5-3-2-4-6-24;/h3-6,11-12,17-18,21,23,25,27H,7-10,13-16,19-20H2,1H3;/q-1; |
| InChIKey | PCMPHNODYDMSIQ-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|