C23H35Y- — CID 59931212
4-[4-(4-methylcyclohexyl)cyclohexyl]butylbenzene;yttrium (PubChem CID 59931212) has the molecular formula C23H35Y- and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-[4-(4-methylcyclohexyl)cyclohexyl]butylbenzene;yttrium.
| Compound Name | 4-[4-(4-methylcyclohexyl)cyclohexyl]butylbenzene;yttrium |
|---|---|
| PubChem CID | 59931212 |
| Molecular Formula | C23H35Y- |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 4-[4-(4-methylcyclohexyl)cyclohexyl]butylbenzene;yttrium |
| SMILES | CC1CCC(C2CCC(CCCCc3cc[c-]cc3)CC2)CC1.[Y] |
| InChI | InChI=1S/C23H35.Y/c1-19-11-15-22(16-12-19)23-17-13-21(14-18-23)10-6-5-9-20-7-3-2-4-8-20;/h3-4,7-8,19,21-23H,5-6,9-18H2,1H3;/q-1; |
| InChIKey | UDKRYZGRXWBYQF-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|