C22H31N — CID 22886911
4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]benzonitrile (PubChem CID 22886911) has the molecular formula C22H31N and a molecular weight of 309.50 g/mol. Its IUPAC name is 4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]benzonitrile.
| Compound Name | 4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 22886911 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]benzonitrile |
| SMILES | CC1CCC(C2CCC(CCc3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H31N/c1-17-2-12-21(13-3-17)22-14-10-19(11-15-22)5-4-18-6-8-20(16-23)9-7-18/h6-9,17,19,21-22H,2-5,10-15H2,1H3 |
| InChIKey | KAHBRDUQEQGTRY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |