C22H38 — CID 159699937
1-methyl-4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]benzene;molecular hydrogen (PubChem CID 159699937) has the molecular formula C22H38 and a molecular weight of 302.55 g/mol. Its IUPAC name is 1-methyl-4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]benzene;molecular hydrogen.
| Compound Name | 1-methyl-4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]benzene;molecular hydrogen |
|---|---|
| PubChem CID | 159699937 |
| Molecular Formula | C22H38 |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.30 |
| IUPAC Name | 1-methyl-4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]benzene;molecular hydrogen |
| SMILES | Cc1ccc(CCC2CCC(C3CCC(C)CC3)CC2)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C22H34.2H2/c1-17-3-7-19(8-4-17)9-10-20-11-15-22(16-12-20)21-13-5-18(2)6-14-21;;/h3-4,7-8,18,20-22H,5-6,9-16H2,1-2H3;2*1H |
| InChIKey | MXMLQSOGCBEULV-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |