C29H38O2 — CID 59938822
(4-methylphenyl) 4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]benzoate (PubChem CID 59938822) has the molecular formula C29H38O2 and a molecular weight of 418.62 g/mol. Its IUPAC name is (4-methylphenyl) 4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]benzoate.
| Compound Name | (4-methylphenyl) 4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]benzoate |
|---|---|
| PubChem CID | 59938822 |
| Molecular Formula | C29H38O2 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (4-methylphenyl) 4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]benzoate |
| SMILES | Cc1ccc(OC(=O)c2ccc(CCC3CCC(C4CCC(C)CC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H38O2/c1-21-3-13-25(14-4-21)26-15-9-23(10-16-26)7-8-24-11-17-27(18-12-24)29(30)31-28-19-5-22(2)6-20-28/h5-6,11-12,17-21,23,25-26H,3-4,7-10,13-16H2,1-2H3 |
| InChIKey | RQYXPXNOCPSIQR-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|