C31H44O4 — CID 139775417
[4-[2-(4-hydroxycyclohexyl)ethyl]phenyl] 4-decoxybenzoate (PubChem CID 139775417) has the molecular formula C31H44O4 and a molecular weight of 480.69 g/mol. Its IUPAC name is [4-[2-(4-hydroxycyclohexyl)ethyl]phenyl] 4-decoxybenzoate.
| Compound Name | [4-[2-(4-hydroxycyclohexyl)ethyl]phenyl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 139775417 |
| Molecular Formula | C31H44O4 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | [4-[2-(4-hydroxycyclohexyl)ethyl]phenyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(CCC3CCC(O)CC3)cc2)cc1 |
| InChI | InChI=1S/C31H44O4/c1-2-3-4-5-6-7-8-9-24-34-29-22-16-27(17-23-29)31(33)35-30-20-14-26(15-21-30)11-10-25-12-18-28(32)19-13-25/h14-17,20-23,25,28,32H,2-13,18-19,24H2,1H3 |
| InChIKey | NGKSOEODMSICFN-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|