C27H42O2 — CID 54119401
[4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl] acetate (PubChem CID 54119401) has the molecular formula C27H42O2 and a molecular weight of 398.63 g/mol. Its IUPAC name is [4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl] acetate.
| Compound Name | [4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl] acetate |
|---|---|
| PubChem CID | 54119401 |
| Molecular Formula | C27H42O2 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | [4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl] acetate |
| SMILES | CCCCCC1CCC(C2CCC(CCc3ccc(OC(C)=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H42O2/c1-3-4-5-6-22-9-15-25(16-10-22)26-17-11-23(12-18-26)7-8-24-13-19-27(20-14-24)29-21(2)28/h13-14,19-20,22-23,25-26H,3-12,15-18H2,1-2H3 |
| InChIKey | NMOUJRVSEAFSLY-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|