C23H29Y+2 — CID 18720895
1-(4-methylcyclohexyl)-4-(4-phenylbutyl)benzene;yttrium(3+) (PubChem CID 18720895) has the molecular formula C23H29Y+2 and a molecular weight of 394.39 g/mol. Its IUPAC name is 1-(4-methylcyclohexyl)-4-(4-phenylbutyl)benzene;yttrium(3+).
| Compound Name | 1-(4-methylcyclohexyl)-4-(4-phenylbutyl)benzene;yttrium(3+) |
|---|---|
| PubChem CID | 18720895 |
| Molecular Formula | C23H29Y+2 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-(4-methylcyclohexyl)-4-(4-phenylbutyl)benzene;yttrium(3+) |
| SMILES | CC1CCC(c2ccc(CCCCc3cc[c-]cc3)cc2)CC1.[Y+3] |
| InChI | InChI=1S/C23H29.Y/c1-19-11-15-22(16-12-19)23-17-13-21(14-18-23)10-6-5-9-20-7-3-2-4-8-20;/h3-4,7-8,13-14,17-19,22H,5-6,9-12,15-16H2,1H3;/q-1;+3 |
| InChIKey | QHIYVTPABXLQHX-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|