C21H23F4N — CID 162565754
4-[2-[3-fluoro-4-[4-(trifluoromethyl)phenyl]phenyl]ethyl]cyclohexan-1-amine (PubChem CID 162565754) has the molecular formula C21H23F4N and a molecular weight of 365.41 g/mol. Its IUPAC name is 4-[2-[3-fluoro-4-[4-(trifluoromethyl)phenyl]phenyl]ethyl]cyclohexan-1-amine.
| Compound Name | 4-[2-[3-fluoro-4-[4-(trifluoromethyl)phenyl]phenyl]ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 162565754 |
| Molecular Formula | C21H23F4N |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 4-[2-[3-fluoro-4-[4-(trifluoromethyl)phenyl]phenyl]ethyl]cyclohexan-1-amine |
| SMILES | NC1CCC(CCc2ccc(-c3ccc(C(F)(F)F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C21H23F4N/c22-20-13-15(2-1-14-3-10-18(26)11-4-14)5-12-19(20)16-6-8-17(9-7-16)21(23,24)25/h5-9,12-14,18H,1-4,10-11,26H2 |
| InChIKey | ZDDPZPBMTYDUPA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |