C24H33F3O — CID 21459472
3-[4-[4-[2-[4-(trifluoromethyl)phenyl]ethyl]cyclohexyl]cyclohexyl]propanal (PubChem CID 21459472) has the molecular formula C24H33F3O and a molecular weight of 394.52 g/mol. Its IUPAC name is 3-[4-[4-[2-[4-(trifluoromethyl)phenyl]ethyl]cyclohexyl]cyclohexyl]propanal.
| Compound Name | 3-[4-[4-[2-[4-(trifluoromethyl)phenyl]ethyl]cyclohexyl]cyclohexyl]propanal |
|---|---|
| PubChem CID | 21459472 |
| Molecular Formula | C24H33F3O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 3-[4-[4-[2-[4-(trifluoromethyl)phenyl]ethyl]cyclohexyl]cyclohexyl]propanal |
| SMILES | O=CCCC1CCC(C2CCC(CCc3ccc(C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H33F3O/c25-24(26,27)23-15-9-20(10-16-23)4-3-19-7-13-22(14-8-19)21-11-5-18(6-12-21)2-1-17-28/h9-10,15-19,21-22H,1-8,11-14H2 |
| InChIKey | NHDHSRATCIRCDV-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|