C25H35F3 — CID 67680891
1-[(Z)-4-[4-(4-ethylcyclohexyl)cyclohexyl]but-2-enyl]-4-(trifluoromethyl)benzene (PubChem CID 67680891) has the molecular formula C25H35F3 and a molecular weight of 392.55 g/mol. Its IUPAC name is 1-[(Z)-4-[4-(4-ethylcyclohexyl)cyclohexyl]but-2-enyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[(Z)-4-[4-(4-ethylcyclohexyl)cyclohexyl]but-2-enyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 67680891 |
| Molecular Formula | C25H35F3 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 1-[(Z)-4-[4-(4-ethylcyclohexyl)cyclohexyl]but-2-enyl]-4-(trifluoromethyl)benzene |
| SMILES | CCC1CCC(C2CCC(C/C=C\Cc3ccc(C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H35F3/c1-2-19-7-13-22(14-8-19)23-15-9-20(10-16-23)5-3-4-6-21-11-17-24(18-12-21)25(26,27)28/h3-4,11-12,17-20,22-23H,2,5-10,13-16H2,1H3/b4-3- |
| InChIKey | ULVXDNFDJPEDRW-ARJAWSKDSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|