C31H33F19 — CID 18650539
1-[2-[4-(4-ethylcyclohexyl)cyclohexyl]ethyl]-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononyl)benzene (PubChem CID 18650539) has the molecular formula C31H33F19 and a molecular weight of 766.57 g/mol. Its IUPAC name is 1-[2-[4-(4-ethylcyclohexyl)cyclohexyl]ethyl]-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononyl)benzene.
| Compound Name | 1-[2-[4-(4-ethylcyclohexyl)cyclohexyl]ethyl]-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononyl)benzene |
|---|---|
| PubChem CID | 18650539 |
| Molecular Formula | C31H33F19 |
| Molecular Weight | 766.57 g/mol |
| Exact Mass | 766.23 |
| IUPAC Name | 1-[2-[4-(4-ethylcyclohexyl)cyclohexyl]ethyl]-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononyl)benzene |
| SMILES | CCC1CCC(C2CCC(CCc3ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C31H33F19/c1-2-17-5-11-20(12-6-17)21-13-7-18(8-14-21)3-4-19-9-15-22(16-10-19)23(32,33)24(34,35)25(36,37)26(38,39)27(40,41)28(42,43)29(44,45)30(46,47)31(48,49)50/h9-10,15-18,20-21H,2-8,11-14H2,1H3 |
| InChIKey | BQDBGRPDSZAKLA-UHFFFAOYSA-N |
| XLogP | 12.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.57 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|