C25H23F11 — CID 20539163
1-(4-ethylcyclohexyl)-4-[4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)phenyl]benzene (PubChem CID 20539163) has the molecular formula C25H23F11 and a molecular weight of 532.44 g/mol. Its IUPAC name is 1-(4-ethylcyclohexyl)-4-[4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)phenyl]benzene.
| Compound Name | 1-(4-ethylcyclohexyl)-4-[4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)phenyl]benzene |
|---|---|
| PubChem CID | 20539163 |
| Molecular Formula | C25H23F11 |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 1-(4-ethylcyclohexyl)-4-[4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)phenyl]benzene |
| SMILES | CCC1CCC(c2ccc(-c3ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C25H23F11/c1-2-15-3-5-16(6-4-15)17-7-9-18(10-8-17)19-11-13-20(14-12-19)21(26,27)22(28,29)23(30,31)24(32,33)25(34,35)36/h7-16H,2-6H2,1H3 |
| InChIKey | DMMHLXOWUWKAKC-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|