C23H21F9 — CID 20539281
1-(4-methylcyclohexyl)-4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]benzene (PubChem CID 20539281) has the molecular formula C23H21F9 and a molecular weight of 468.40 g/mol. Its IUPAC name is 1-(4-methylcyclohexyl)-4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]benzene.
| Compound Name | 1-(4-methylcyclohexyl)-4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]benzene |
|---|---|
| PubChem CID | 20539281 |
| Molecular Formula | C23H21F9 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 1-(4-methylcyclohexyl)-4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]benzene |
| SMILES | CC1CCC(c2ccc(-c3ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C23H21F9/c1-14-2-4-15(5-3-14)16-6-8-17(9-7-16)18-10-12-19(13-11-18)20(24,25)21(26,27)22(28,29)23(30,31)32/h6-15H,2-5H2,1H3 |
| InChIKey | CGVOWAFMGCGJNC-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|