C28H33F7 — CID 20539041
1-(1,1,2,2,3,3,3-heptafluoropropyl)-4-[4-(4-heptylcyclohexyl)phenyl]benzene (PubChem CID 20539041) has the molecular formula C28H33F7 and a molecular weight of 502.56 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,3-heptafluoropropyl)-4-[4-(4-heptylcyclohexyl)phenyl]benzene.
| Compound Name | 1-(1,1,2,2,3,3,3-heptafluoropropyl)-4-[4-(4-heptylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 20539041 |
| Molecular Formula | C28H33F7 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 1-(1,1,2,2,3,3,3-heptafluoropropyl)-4-[4-(4-heptylcyclohexyl)phenyl]benzene |
| SMILES | CCCCCCCC1CCC(c2ccc(-c3ccc(C(F)(F)C(F)(F)C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H33F7/c1-2-3-4-5-6-7-20-8-10-21(11-9-20)22-12-14-23(15-13-22)24-16-18-25(19-17-24)26(29,30)27(31,32)28(33,34)35/h12-21H,2-11H2,1H3 |
| InChIKey | ZHSMDBWHGAEUGD-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|