C27H34F4 — CID 23188569
1-(4-butylcyclohexyl)-4-[4-(1,1,2,2-tetrafluoropentyl)phenyl]benzene (PubChem CID 23188569) has the molecular formula C27H34F4 and a molecular weight of 434.56 g/mol. Its IUPAC name is 1-(4-butylcyclohexyl)-4-[4-(1,1,2,2-tetrafluoropentyl)phenyl]benzene.
| Compound Name | 1-(4-butylcyclohexyl)-4-[4-(1,1,2,2-tetrafluoropentyl)phenyl]benzene |
|---|---|
| PubChem CID | 23188569 |
| Molecular Formula | C27H34F4 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 1-(4-butylcyclohexyl)-4-[4-(1,1,2,2-tetrafluoropentyl)phenyl]benzene |
| SMILES | CCCCC1CCC(c2ccc(-c3ccc(C(F)(F)C(F)(F)CCC)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H34F4/c1-3-5-6-20-7-9-21(10-8-20)22-11-13-23(14-12-22)24-15-17-25(18-16-24)27(30,31)26(28,29)19-4-2/h11-18,20-21H,3-10,19H2,1-2H3 |
| InChIKey | HYJFLEVORFQBJA-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|